About 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol
3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol (PubChem CID 66489160) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol.
Analyze 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol?
The IUPAC name of 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol (CID 66489160) is 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol.
What is the SMILES notation for 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol?
The canonical SMILES for 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol is Cc1[nH]nc2c1C(O)CC2.
What is the InChIKey of 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol?
The InChIKey is QNKMQDBMVILGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-4-7-5(9-8-4)2-3-6(7)10/h6,10H,2-3H2,1H3,(H,8,9).
What are the key properties of 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol?
3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol has a molecular weight of 138.17 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-ol is sourced from PubChem (CID 66489160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).