About methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate
methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate (PubChem CID 66489404) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate |
| PubChem CID | 66489404 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate |
| SMILES | COC(=O)C1C(=O)c2cnc(N)nc2CC1(C)C |
| InChI | InChI=1S/C12H15N3O3/c1-12(2)4-7-6(5-14-11(13)15-7)9(16)8(12)10(17)18-3/h5,8H,4H2,1-3H3,(H2,13,14,15) |
| InChIKey | RKBSCUCWPLHEGG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate?
The IUPAC name of methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate (CID 66489404) is methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate.
What is the SMILES notation for methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate?
The canonical SMILES for methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate is COC(=O)C1C(=O)c2cnc(N)nc2CC1(C)C.
What is the InChIKey of methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate?
The InChIKey is RKBSCUCWPLHEGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3/c1-12(2)4-7-6(5-14-11(13)15-7)9(16)8(12)10(17)18-3/h5,8H,4H2,1-3H3,(H2,13,14,15).
What are the key properties of methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate?
methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate has a molecular weight of 249.27 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-6-carboxylate is sourced from PubChem (CID 66489404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).