C13H17N3 — CID 66489678
3-phenyl-3,5,6,7,8,9-hexahydro-2H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 66489678) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-phenyl-3,5,6,7,8,9-hexahydro-2H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-phenyl-3,5,6,7,8,9-hexahydro-2H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 66489678 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-phenyl-3,5,6,7,8,9-hexahydro-2H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | c1ccc(C2NN=C3CCCCCN32)cc1 |
| InChI | InChI=1S/C13H17N3/c1-3-7-11(8-4-1)13-15-14-12-9-5-2-6-10-16(12)13/h1,3-4,7-8,13,15H,2,5-6,9-10H2 |
| InChIKey | ZGDOBVDFAKRZRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |