C8H7N7O — CID 66489926
11-amino-4-methyl-2,3,5,7,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66489926) has the molecular formula C8H7N7O and a molecular weight of 217.19 g/mol. Its IUPAC name is 11-amino-4-methyl-2,3,5,7,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-amino-4-methyl-2,3,5,7,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66489926 |
| Molecular Formula | C8H7N7O |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 11-amino-4-methyl-2,3,5,7,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | Cc1nc2ncc3c(=O)n(N)cnc3n2n1 |
| InChI | InChI=1S/C8H7N7O/c1-4-12-8-10-2-5-6(15(8)13-4)11-3-14(9)7(5)16/h2-3H,9H2,1H3 |
| InChIKey | NQJZIOMWBRZJIJ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |