C15H13N5O4S — CID 66491848
ethyl 2-[[7-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetate (PubChem CID 66491848) has the molecular formula C15H13N5O4S and a molecular weight of 359.37 g/mol. Its IUPAC name is ethyl 2-[[7-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[7-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 66491848 |
| Molecular Formula | C15H13N5O4S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | ethyl 2-[[7-(3-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc2nccc(-c3cccc([N+](=O)[O-])c3)n2n1 |
| InChI | InChI=1S/C15H13N5O4S/c1-2-24-13(21)9-25-15-17-14-16-7-6-12(19(14)18-15)10-4-3-5-11(8-10)20(22)23/h3-8H,2,9H2,1H3 |
| InChIKey | IDRLLHWDFIMUEO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|