About 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one
3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one (PubChem CID 664929) has the molecular formula C14H13N3O4
and a molecular weight of 287.28 g/mol. Its IUPAC name is 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one |
| PubChem CID | 664929 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one |
| SMILES | COc1cc(OC)nc(NC2OC(=O)c3ccccc32)n1 |
| InChI | InChI=1S/C14H13N3O4/c1-19-10-7-11(20-2)16-14(15-10)17-12-8-5-3-4-6-9(8)13(18)21-12/h3-7,12H,1-2H3,(H,15,16,17) |
| InChIKey | KKGDLRLPGOIXOH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one?
The IUPAC name of 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one (CID 664929) is 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one?
The canonical SMILES for 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one is COc1cc(OC)nc(NC2OC(=O)c3ccccc32)n1.
What is the InChIKey of 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one?
The InChIKey is KKGDLRLPGOIXOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O4/c1-19-10-7-11(20-2)16-14(15-10)17-12-8-5-3-4-6-9(8)13(18)21-12/h3-7,12H,1-2H3,(H,15,16,17).
What are the key properties of 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one?
3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one has a molecular weight of 287.28 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethoxypyrimidin-2-yl)amino]-3H-2-benzofuran-1-one is sourced from PubChem (CID 664929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).