C12H16N4 — CID 664932
8-propyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine (PubChem CID 664932) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 8-propyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine.
| Compound Name | 8-propyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 664932 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 8-propyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-3-amine |
| SMILES | CCCc1nc2n[nH]c(N)c2c2c1CCC2 |
| InChI | InChI=1S/C12H16N4/c1-2-4-9-7-5-3-6-8(7)10-11(13)15-16-12(10)14-9/h2-6H2,1H3,(H3,13,14,15,16) |
| InChIKey | YWIMPGSKZAOEPV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |