C15H14N4S — CID 664949
4-(5-benzylsulfanyl-4-methyl-1,2,4-triazol-3-yl)pyridine (PubChem CID 664949) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-(5-benzylsulfanyl-4-methyl-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 4-(5-benzylsulfanyl-4-methyl-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 664949 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(5-benzylsulfanyl-4-methyl-1,2,4-triazol-3-yl)pyridine |
| SMILES | Cn1c(SCc2ccccc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C15H14N4S/c1-19-14(13-7-9-16-10-8-13)17-18-15(19)20-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | WDMMTZDSTCLQFC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |