C11H11N5O2 — CID 66495161
2,4-dimethyl-5-(1H-pyrazol-5-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 66495161) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2,4-dimethyl-5-(1H-pyrazol-5-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2,4-dimethyl-5-(1H-pyrazol-5-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 66495161 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2,4-dimethyl-5-(1H-pyrazol-5-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | Cc1c2c(=O)n(C)[nH]c2cc(=O)n1-c1ccn[nH]1 |
| InChI | InChI=1S/C11H11N5O2/c1-6-10-7(14-15(2)11(10)18)5-9(17)16(6)8-3-4-12-13-8/h3-5,14H,1-2H3,(H,12,13) |
| InChIKey | WEXOQRGXSPLBIB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|