C21H29N3O3 — CID 66495383
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-7-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 66495383) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-7-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-7-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66495383 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-7-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1CC(=O)c2cc(C(=O)NCC3CCCN4CCCCC34)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C21H29N3O3/c1-13-9-17-15(19(25)10-13)11-16(21(27)23-17)20(26)22-12-14-5-4-8-24-7-3-2-6-18(14)24/h11,13-14,18H,2-10,12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | IYWVGGGOGYEJLN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |