C21H22N2O3 — CID 66495462
N-cyclopentyl-2,5-dioxo-7-phenyl-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 66495462) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-cyclopentyl-2,5-dioxo-7-phenyl-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-cyclopentyl-2,5-dioxo-7-phenyl-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66495462 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-cyclopentyl-2,5-dioxo-7-phenyl-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C1CC(c2ccccc2)Cc2[nH]c(=O)c(C(=O)NC3CCCC3)cc21 |
| InChI | InChI=1S/C21H22N2O3/c24-19-11-14(13-6-2-1-3-7-13)10-18-16(19)12-17(21(26)23-18)20(25)22-15-8-4-5-9-15/h1-3,6-7,12,14-15H,4-5,8-11H2,(H,22,25)(H,23,26) |
| InChIKey | YFBMOKJIUQUZGN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |