C13H9N7 — CID 66495701
11-phenyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-imine (PubChem CID 66495701) has the molecular formula C13H9N7 and a molecular weight of 263.26 g/mol. Its IUPAC name is 11-phenyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-imine.
| Compound Name | 11-phenyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-imine |
|---|---|
| PubChem CID | 66495701 |
| Molecular Formula | C13H9N7 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 11-phenyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-imine |
| SMILES | [H]/N=c1\c2nnc3ncnn3c2ccn1-c1ccccc1 |
| InChI | InChI=1S/C13H9N7/c14-12-11-10(20-13(18-17-11)15-8-16-20)6-7-19(12)9-4-2-1-3-5-9/h1-8,14H/b14-12+ |
| InChIKey | HFLSZNPTRBZVFM-WYMLVPIESA-N |
| XLogP | 0.94 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |