About methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate
methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate (PubChem CID 664973) has the molecular formula C15H14N4O2S
and a molecular weight of 314.37 g/mol. Its IUPAC name is methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate |
| PubChem CID | 664973 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1ncnc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C15H14N4O2S/c1-21-13(20)9-22-15-12-7-18-19(14(12)16-10-17-15)8-11-5-3-2-4-6-11/h2-7,10H,8-9H2,1H3 |
| InChIKey | RZMXDEOGIGKOAL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
The IUPAC name of methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate (CID 664973) is methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate.
What is the SMILES notation for methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
The canonical SMILES for methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate is COC(=O)CSc1ncnc2c1cnn2Cc1ccccc1.
What is the InChIKey of methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
The InChIKey is RZMXDEOGIGKOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2S/c1-21-13(20)9-22-15-12-7-18-19(14(12)16-10-17-15)8-11-5-3-2-4-6-11/h2-7,10H,8-9H2,1H3.
What are the key properties of methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate has a molecular weight of 314.37 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-benzylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate is sourced from PubChem (CID 664973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).