C18H12F2N2O2 — CID 66497927
N-(3,4-difluorophenyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide (PubChem CID 66497927) has the molecular formula C18H12F2N2O2 and a molecular weight of 326.30 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66497927 |
| Molecular Formula | C18H12F2N2O2 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C18H12F2N2O2/c19-14-8-6-12(10-15(14)20)21-17(23)13-7-9-16(22-18(13)24)11-4-2-1-3-5-11/h1-10H,(H,21,23)(H,22,24) |
| InChIKey | LYCCPPWUMISFSR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |