C17H11ClN4 — CID 66498295
2-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 66498295) has the molecular formula C17H11ClN4 and a molecular weight of 306.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 66498295 |
| Molecular Formula | C17H11ClN4 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Clc1ccc(-c2nc3nccc(-c4ccccc4)n3n2)cc1 |
| InChI | InChI=1S/C17H11ClN4/c18-14-8-6-13(7-9-14)16-20-17-19-11-10-15(22(17)21-16)12-4-2-1-3-5-12/h1-11H |
| InChIKey | GDWATMPFJVKYGE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |