C16H20N2O4 — CID 66498582
methyl 7-(3-methoxypropyl)-1,3-dimethyl-8-oxo-2,7-naphthyridine-4-carboxylate (PubChem CID 66498582) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl 7-(3-methoxypropyl)-1,3-dimethyl-8-oxo-2,7-naphthyridine-4-carboxylate.
| Compound Name | methyl 7-(3-methoxypropyl)-1,3-dimethyl-8-oxo-2,7-naphthyridine-4-carboxylate |
|---|---|
| PubChem CID | 66498582 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | methyl 7-(3-methoxypropyl)-1,3-dimethyl-8-oxo-2,7-naphthyridine-4-carboxylate |
| SMILES | COCCCn1ccc2c(C(=O)OC)c(C)nc(C)c2c1=O |
| InChI | InChI=1S/C16H20N2O4/c1-10-13-12(14(11(2)17-10)16(20)22-4)6-8-18(15(13)19)7-5-9-21-3/h6,8H,5,7,9H2,1-4H3 |
| InChIKey | YREARVVMCIOWPD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|