C20H21N3O6 — CID 66498784
2-methoxyethyl 1-[(4-methoxyphenyl)methyl]-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 66498784) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 2-methoxyethyl 1-[(4-methoxyphenyl)methyl]-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 1-[(4-methoxyphenyl)methyl]-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 66498784 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-methoxyethyl 1-[(4-methoxyphenyl)methyl]-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1cc2c(=O)[nH]c(=O)n(Cc3ccc(OC)cc3)c2nc1C |
| InChI | InChI=1S/C20H21N3O6/c1-12-15(19(25)29-9-8-27-2)10-16-17(21-12)23(20(26)22-18(16)24)11-13-4-6-14(28-3)7-5-13/h4-7,10H,8-9,11H2,1-3H3,(H,22,24,26) |
| InChIKey | GMBICHFIPHWDHJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|