C16H9F3N6O2 — CID 66498934
11-(4-acetylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66498934) has the molecular formula C16H9F3N6O2 and a molecular weight of 374.28 g/mol. Its IUPAC name is 11-(4-acetylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(4-acetylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66498934 |
| Molecular Formula | C16H9F3N6O2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 11-(4-acetylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CC(=O)c1ccc(-n2ccc3c(nnc4nc(C(F)(F)F)nn43)c2=O)cc1 |
| InChI | InChI=1S/C16H9F3N6O2/c1-8(26)9-2-4-10(5-3-9)24-7-6-11-12(13(24)27)21-22-15-20-14(16(17,18)19)23-25(11)15/h2-7H,1H3 |
| InChIKey | VBCJLBMVSXSAAZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |