C16H11F3N6O — CID 66498965
11-(3,5-dimethylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66498965) has the molecular formula C16H11F3N6O and a molecular weight of 360.30 g/mol. Its IUPAC name is 11-(3,5-dimethylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(3,5-dimethylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66498965 |
| Molecular Formula | C16H11F3N6O |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 11-(3,5-dimethylphenyl)-4-(trifluoromethyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | Cc1cc(C)cc(-n2ccc3c(nnc4nc(C(F)(F)F)nn43)c2=O)c1 |
| InChI | InChI=1S/C16H11F3N6O/c1-8-5-9(2)7-10(6-8)24-4-3-11-12(13(24)26)21-22-15-20-14(16(17,18)19)23-25(11)15/h3-7H,1-2H3 |
| InChIKey | FHEHPDUCDASYCM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |