C20H15N7O2 — CID 66499389
8-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione (PubChem CID 66499389) has the molecular formula C20H15N7O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 8-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione.
| Compound Name | 8-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione |
|---|---|
| PubChem CID | 66499389 |
| Molecular Formula | C20H15N7O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 8-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione |
| SMILES | Cc1nnc(C)n1-n1ccc2c(cnc3ccn(-c4ccccn4)c(=O)c32)c1=O |
| InChI | InChI=1S/C20H15N7O2/c1-12-23-24-13(2)27(12)26-10-6-14-15(19(26)28)11-22-16-7-9-25(20(29)18(14)16)17-5-3-4-8-21-17/h3-11H,1-2H3 |
| InChIKey | OUQCXZUWUBWISN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|