C24H17ClN4O2 — CID 66499478
8-[1-(4-chlorophenyl)ethyl]-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione (PubChem CID 66499478) has the molecular formula C24H17ClN4O2 and a molecular weight of 428.88 g/mol. Its IUPAC name is 8-[1-(4-chlorophenyl)ethyl]-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione.
| Compound Name | 8-[1-(4-chlorophenyl)ethyl]-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione |
|---|---|
| PubChem CID | 66499478 |
| Molecular Formula | C24H17ClN4O2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 8-[1-(4-chlorophenyl)ethyl]-2-pyridin-2-ylpyrido[3,4-c][1,6]naphthyridine-1,7-dione |
| SMILES | CC(c1ccc(Cl)cc1)n1ccc2c(cnc3ccn(-c4ccccn4)c(=O)c32)c1=O |
| InChI | InChI=1S/C24H17ClN4O2/c1-15(16-5-7-17(25)8-6-16)28-12-9-18-19(23(28)30)14-27-20-10-13-29(24(31)22(18)20)21-4-2-3-11-26-21/h2-15H,1H3 |
| InChIKey | RDMYWVGISIMMPY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|