C22H20N4O3 — CID 66499564
8-(oxolan-2-ylmethyl)-2-(pyridin-3-ylmethyl)pyrido[3,4-c][1,6]naphthyridine-1,7-dione (PubChem CID 66499564) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 8-(oxolan-2-ylmethyl)-2-(pyridin-3-ylmethyl)pyrido[3,4-c][1,6]naphthyridine-1,7-dione.
| Compound Name | 8-(oxolan-2-ylmethyl)-2-(pyridin-3-ylmethyl)pyrido[3,4-c][1,6]naphthyridine-1,7-dione |
|---|---|
| PubChem CID | 66499564 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 8-(oxolan-2-ylmethyl)-2-(pyridin-3-ylmethyl)pyrido[3,4-c][1,6]naphthyridine-1,7-dione |
| SMILES | O=c1c2cnc3ccn(Cc4cccnc4)c(=O)c3c2ccn1CC1CCCO1 |
| InChI | InChI=1S/C22H20N4O3/c27-21-18-12-24-19-6-9-25(13-15-3-1-7-23-11-15)22(28)20(19)17(18)5-8-26(21)14-16-4-2-10-29-16/h1,3,5-9,11-12,16H,2,4,10,13-14H2 |
| InChIKey | QATIRGGUGCBFLM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|