C24H24ClN3O2 — CID 66501645
3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 66501645) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 66501645 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CC(N3CCc4c([nH]c5ccc(Cl)cc45)C3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H24ClN3O2/c1-13-4-7-20(14(2)10-13)28-22(29)12-21(24(28)30)27-9-8-17-18-11-16(25)5-6-19(18)26-23(17)15(27)3/h4-7,10-11,15,21,26H,8-9,12H2,1-3H3 |
| InChIKey | CSMCPONVXIVRRT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|