C23H19ClF3N3O3 — CID 66501698
3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione (PubChem CID 66501698) has the molecular formula C23H19ClF3N3O3 and a molecular weight of 477.87 g/mol. Its IUPAC name is 3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 66501698 |
| Molecular Formula | C23H19ClF3N3O3 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 3-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
| SMILES | CC1c2[nH]c3ccc(Cl)cc3c2CCN1C1CC(=O)N(c2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C23H19ClF3N3O3/c1-12-21-16(17-10-13(24)2-7-18(17)28-21)8-9-29(12)19-11-20(31)30(22(19)32)14-3-5-15(6-4-14)33-23(25,26)27/h2-7,10,12,19,28H,8-9,11H2,1H3 |
| InChIKey | CZUDTQVNLAMFNF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|