C25H23N7O — CID 66502817
6-ethoxy-4-methyl-N-[4-(3-methyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]quinazolin-2-amine (PubChem CID 66502817) has the molecular formula C25H23N7O and a molecular weight of 437.51 g/mol. Its IUPAC name is 6-ethoxy-4-methyl-N-[4-(3-methyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]quinazolin-2-amine.
| Compound Name | 6-ethoxy-4-methyl-N-[4-(3-methyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 66502817 |
| Molecular Formula | C25H23N7O |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 6-ethoxy-4-methyl-N-[4-(3-methyl-1-phenylpyrazol-4-yl)pyrimidin-2-yl]quinazolin-2-amine |
| SMILES | CCOc1ccc2nc(Nc3nccc(-c4cn(-c5ccccc5)nc4C)n3)nc(C)c2c1 |
| InChI | InChI=1S/C25H23N7O/c1-4-33-19-10-11-22-20(14-19)16(2)27-25(29-22)30-24-26-13-12-23(28-24)21-15-32(31-17(21)3)18-8-6-5-7-9-18/h5-15H,4H2,1-3H3,(H,26,27,28,29,30) |
| InChIKey | AGPSZPQKYIMWPN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |