C19H21ClN6 — CID 66503193
4-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-(4-methylpiperazin-1-yl)pyrimidine (PubChem CID 66503193) has the molecular formula C19H21ClN6 and a molecular weight of 368.87 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-(4-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-(4-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 66503193 |
| Molecular Formula | C19H21ClN6 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-(4-methylpiperazin-1-yl)pyrimidine |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)cc1-c1ccnc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C19H21ClN6/c1-14-17(13-26(23-14)16-5-3-15(20)4-6-16)18-7-8-21-19(22-18)25-11-9-24(2)10-12-25/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | DMSLNSVIKSSDSF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |