C12H15N7O3S — CID 66503381
methyl 2-[11-(2-methoxyethylsulfanyl)-3-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate (PubChem CID 66503381) has the molecular formula C12H15N7O3S and a molecular weight of 337.37 g/mol. Its IUPAC name is methyl 2-[11-(2-methoxyethylsulfanyl)-3-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[11-(2-methoxyethylsulfanyl)-3-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 66503381 |
| Molecular Formula | C12H15N7O3S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | methyl 2-[11-(2-methoxyethylsulfanyl)-3-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
| SMILES | COCCSc1nc2nnc3c(CC(=O)OC)nn(C)c3n2n1 |
| InChI | InChI=1S/C12H15N7O3S/c1-18-10-9(7(16-18)6-8(20)22-3)14-15-11-13-12(17-19(10)11)23-5-4-21-2/h4-6H2,1-3H3 |
| InChIKey | JORZIBUOXJBFLM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 109.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|