C16H18N4O2 — CID 66504382
N-(3-hydroxyphenyl)-4-methyl-2-pyrrolidin-1-ylpyrimidine-5-carboxamide (PubChem CID 66504382) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-4-methyl-2-pyrrolidin-1-ylpyrimidine-5-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-4-methyl-2-pyrrolidin-1-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66504382 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(3-hydroxyphenyl)-4-methyl-2-pyrrolidin-1-ylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N2CCCC2)ncc1C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C16H18N4O2/c1-11-14(10-17-16(18-11)20-7-2-3-8-20)15(22)19-12-5-4-6-13(21)9-12/h4-6,9-10,21H,2-3,7-8H2,1H3,(H,19,22) |
| InChIKey | JSUHFRMXNYJGIO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |