C16H16ClFN4O2 — CID 66504421
N-(3-chloro-4-fluorophenyl)-4-methyl-2-morpholin-4-ylpyrimidine-5-carboxamide (PubChem CID 66504421) has the molecular formula C16H16ClFN4O2 and a molecular weight of 350.78 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-methyl-2-morpholin-4-ylpyrimidine-5-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-methyl-2-morpholin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66504421 |
| Molecular Formula | C16H16ClFN4O2 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-methyl-2-morpholin-4-ylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N2CCOCC2)ncc1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClFN4O2/c1-10-12(9-19-16(20-10)22-4-6-24-7-5-22)15(23)21-11-2-3-14(18)13(17)8-11/h2-3,8-9H,4-7H2,1H3,(H,21,23) |
| InChIKey | FJUZGVNVXNKWKK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |