C16H15N5O2S — CID 66504899
4-(methoxymethyl)-11-(1-thiophen-3-ylethyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66504899) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is 4-(methoxymethyl)-11-(1-thiophen-3-ylethyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-(methoxymethyl)-11-(1-thiophen-3-ylethyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66504899 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-(methoxymethyl)-11-(1-thiophen-3-ylethyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COCc1nc2ncc3c(=O)n(C(C)c4ccsc4)ccc3n2n1 |
| InChI | InChI=1S/C16H15N5O2S/c1-10(11-4-6-24-9-11)20-5-3-13-12(15(20)22)7-17-16-18-14(8-23-2)19-21(13)16/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | FFFKMTDOTWHGIX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |