C18H20N8O — CID 66504901
4-cyclohexyl-11-(5-ethyl-1H-1,2,4-triazol-3-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66504901) has the molecular formula C18H20N8O and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-cyclohexyl-11-(5-ethyl-1H-1,2,4-triazol-3-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-cyclohexyl-11-(5-ethyl-1H-1,2,4-triazol-3-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66504901 |
| Molecular Formula | C18H20N8O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-cyclohexyl-11-(5-ethyl-1H-1,2,4-triazol-3-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CCc1nc(-n2ccc3c(cnc4nc(C5CCCCC5)nn43)c2=O)n[nH]1 |
| InChI | InChI=1S/C18H20N8O/c1-2-14-20-18(23-22-14)25-9-8-13-12(16(25)27)10-19-17-21-15(24-26(13)17)11-6-4-3-5-7-11/h8-11H,2-7H2,1H3,(H,20,22,23) |
| InChIKey | JRSXYGVEBUEFLO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |