C17H13N5O3 — CID 66505087
methyl 11-(2-methylphenyl)-10-oxo-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate (PubChem CID 66505087) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is methyl 11-(2-methylphenyl)-10-oxo-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate.
| Compound Name | methyl 11-(2-methylphenyl)-10-oxo-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 66505087 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | methyl 11-(2-methylphenyl)-10-oxo-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate |
| SMILES | COC(=O)c1cnn2c1nnc1c(=O)n(-c3ccccc3C)ccc12 |
| InChI | InChI=1S/C17H13N5O3/c1-10-5-3-4-6-12(10)21-8-7-13-14(16(21)23)19-20-15-11(17(24)25-2)9-18-22(13)15/h3-9H,1-2H3 |
| InChIKey | RDPBOMKCVCGJMM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |