C15H24N4O — CID 66505240
4-methyl-2-(4-methylpiperidin-1-yl)-N-propan-2-ylpyrimidine-5-carboxamide (PubChem CID 66505240) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-methyl-2-(4-methylpiperidin-1-yl)-N-propan-2-ylpyrimidine-5-carboxamide.
| Compound Name | 4-methyl-2-(4-methylpiperidin-1-yl)-N-propan-2-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66505240 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-methyl-2-(4-methylpiperidin-1-yl)-N-propan-2-ylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N2CCC(C)CC2)ncc1C(=O)NC(C)C |
| InChI | InChI=1S/C15H24N4O/c1-10(2)17-14(20)13-9-16-15(18-12(13)4)19-7-5-11(3)6-8-19/h9-11H,5-8H2,1-4H3,(H,17,20) |
| InChIKey | YPXSBCDIHBZESW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |