C18H17N5O3S — CID 66505493
8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-7,9-dihydro-[1,2,4]triazolo[1,5-a]quinazolin-6-one (PubChem CID 66505493) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-7,9-dihydro-[1,2,4]triazolo[1,5-a]quinazolin-6-one.
| Compound Name | 8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-7,9-dihydro-[1,2,4]triazolo[1,5-a]quinazolin-6-one |
|---|---|
| PubChem CID | 66505493 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-7,9-dihydro-[1,2,4]triazolo[1,5-a]quinazolin-6-one |
| SMILES | CC1(C)CC(=O)c2cnc3nc(SCc4ccc([N+](=O)[O-])cc4)nn3c2C1 |
| InChI | InChI=1S/C18H17N5O3S/c1-18(2)7-14-13(15(24)8-18)9-19-16-20-17(21-22(14)16)27-10-11-3-5-12(6-4-11)23(25)26/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | PJSGZQNNTRUNHB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|