C13H16N4O2S — CID 66505553
2-(2-methoxyethylsulfanyl)-8-methyl-8,9-dihydro-7H-[1,2,4]triazolo[1,5-a]quinazolin-6-one (PubChem CID 66505553) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfanyl)-8-methyl-8,9-dihydro-7H-[1,2,4]triazolo[1,5-a]quinazolin-6-one.
| Compound Name | 2-(2-methoxyethylsulfanyl)-8-methyl-8,9-dihydro-7H-[1,2,4]triazolo[1,5-a]quinazolin-6-one |
|---|---|
| PubChem CID | 66505553 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(2-methoxyethylsulfanyl)-8-methyl-8,9-dihydro-7H-[1,2,4]triazolo[1,5-a]quinazolin-6-one |
| SMILES | COCCSc1nc2ncc3c(n2n1)CC(C)CC3=O |
| InChI | InChI=1S/C13H16N4O2S/c1-8-5-10-9(11(18)6-8)7-14-12-15-13(16-17(10)12)20-4-3-19-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | JGCFNPYQEUUJHZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|