C14H9N7O2 — CID 66505689
N-(10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide (PubChem CID 66505689) has the molecular formula C14H9N7O2 and a molecular weight of 307.27 g/mol. Its IUPAC name is N-(10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide.
| Compound Name | N-(10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide |
|---|---|
| PubChem CID | 66505689 |
| Molecular Formula | C14H9N7O2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide |
| SMILES | O=C(Nn1ccc2c(nnc3ncnn32)c1=O)c1ccccc1 |
| InChI | InChI=1S/C14H9N7O2/c22-12(9-4-2-1-3-5-9)19-20-7-6-10-11(13(20)23)17-18-14-15-8-16-21(10)14/h1-8H,(H,19,22) |
| InChIKey | IILHUIYSSOLELM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |