C22H18N6O3 — CID 66506396
5-(4,6-dimethylpyrimidin-2-yl)-11-(3-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66506396) has the molecular formula C22H18N6O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is 5-(4,6-dimethylpyrimidin-2-yl)-11-(3-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 5-(4,6-dimethylpyrimidin-2-yl)-11-(3-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506396 |
| Molecular Formula | C22H18N6O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-(4,6-dimethylpyrimidin-2-yl)-11-(3-methoxyphenyl)-3-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | COc1cccc(N2C(=O)c3cnc4c(c(C)nn4-c4nc(C)cc(C)n4)c3C2=O)c1 |
| InChI | InChI=1S/C22H18N6O3/c1-11-8-12(2)25-22(24-11)28-19-17(13(3)26-28)18-16(10-23-19)20(29)27(21(18)30)14-6-5-7-15(9-14)31-4/h5-10H,1-4H3 |
| InChIKey | FEXFBDNGVGUDDD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|