C21H12FN5O4 — CID 66506467
5-(2-fluorophenyl)-3-methyl-11-(2-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66506467) has the molecular formula C21H12FN5O4 and a molecular weight of 417.36 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-3-methyl-11-(2-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 5-(2-fluorophenyl)-3-methyl-11-(2-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506467 |
| Molecular Formula | C21H12FN5O4 |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 5-(2-fluorophenyl)-3-methyl-11-(2-nitrophenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | Cc1nn(-c2ccccc2F)c2ncc3c(c12)C(=O)N(c1ccccc1[N+](=O)[O-])C3=O |
| InChI | InChI=1S/C21H12FN5O4/c1-11-17-18-12(10-23-19(17)26(24-11)14-7-3-2-6-13(14)22)20(28)25(21(18)29)15-8-4-5-9-16(15)27(30)31/h2-10H,1H3 |
| InChIKey | KXOHUIRKIYFBKG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|