C20H22N2O2S — CID 66507614
2-(4-methylpiperidin-1-yl)-1-(5-oxophenothiazin-10-yl)ethanone (PubChem CID 66507614) has the molecular formula C20H22N2O2S and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-1-(5-oxophenothiazin-10-yl)ethanone.
| Compound Name | 2-(4-methylpiperidin-1-yl)-1-(5-oxophenothiazin-10-yl)ethanone |
|---|---|
| PubChem CID | 66507614 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-1-(5-oxophenothiazin-10-yl)ethanone |
| SMILES | CC1CCN(CC(=O)N2c3ccccc3S(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C20H22N2O2S/c1-15-10-12-21(13-11-15)14-20(23)22-16-6-2-4-8-18(16)25(24)19-9-5-3-7-17(19)22/h2-9,15H,10-14H2,1H3 |
| InChIKey | QHWKNCQFJOVONE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |