C23H16ClN5O3 — CID 66507992
N-[4-[5-(4-chlorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]phenyl]acetamide (PubChem CID 66507992) has the molecular formula C23H16ClN5O3 and a molecular weight of 445.87 g/mol. Its IUPAC name is N-[4-[5-(4-chlorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]phenyl]acetamide.
| Compound Name | N-[4-[5-(4-chlorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 66507992 |
| Molecular Formula | C23H16ClN5O3 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[4-[5-(4-chlorophenyl)-3-methyl-10,12-dioxo-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-11-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3cnc4c(c(C)nn4-c4ccc(Cl)cc4)c3C2=O)cc1 |
| InChI | InChI=1S/C23H16ClN5O3/c1-12-19-20-18(11-25-21(19)29(27-12)17-7-3-14(24)4-8-17)22(31)28(23(20)32)16-9-5-15(6-10-16)26-13(2)30/h3-11H,1-2H3,(H,26,30) |
| InChIKey | HDQSGNBMLCMJRN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|