C16H10ClFN4O2 — CID 66508062
11-(3-chloro-4-fluorophenyl)-3,5-dimethyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66508062) has the molecular formula C16H10ClFN4O2 and a molecular weight of 344.73 g/mol. Its IUPAC name is 11-(3-chloro-4-fluorophenyl)-3,5-dimethyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-(3-chloro-4-fluorophenyl)-3,5-dimethyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66508062 |
| Molecular Formula | C16H10ClFN4O2 |
| Molecular Weight | 344.73 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 11-(3-chloro-4-fluorophenyl)-3,5-dimethyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | Cc1nn(C)c2ncc3c(c12)C(=O)N(c1ccc(F)c(Cl)c1)C3=O |
| InChI | InChI=1S/C16H10ClFN4O2/c1-7-12-13-9(6-19-14(12)21(2)20-7)15(23)22(16(13)24)8-3-4-11(18)10(17)5-8/h3-6H,1-2H3 |
| InChIKey | RFAZVPLBAZYWMC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|