C22H21N5O3 — CID 66508886
11-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66508886) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 11-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66508886 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 11-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | O=c1c2cnc3nc(-c4ccc5c(c4)OCCO5)nn3c2ccn1C1CCCCC1 |
| InChI | InChI=1S/C22H21N5O3/c28-21-16-13-23-22-24-20(14-6-7-18-19(12-14)30-11-10-29-18)25-27(22)17(16)8-9-26(21)15-4-2-1-3-5-15/h6-9,12-13,15H,1-5,10-11H2 |
| InChIKey | UKPCEZOQPCRKQM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |