About 1-(2,2-difluoroethyl)pyrazole-3,4-diamine
1-(2,2-difluoroethyl)pyrazole-3,4-diamine (PubChem CID 66509523) has the molecular formula C5H8F2N4
and a molecular weight of 162.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrazole-3,4-diamine.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)pyrazole-3,4-diamine |
| PubChem CID | 66509523 |
| Molecular Formula | C5H8F2N4 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrazole-3,4-diamine |
| SMILES | Nc1cn(CC(F)F)nc1N |
| InChI | InChI=1S/C5H8F2N4/c6-4(7)2-11-1-3(8)5(9)10-11/h1,4H,2,8H2,(H2,9,10) |
| InChIKey | LAANYDXEGIGUEW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2-difluoroethyl)pyrazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)pyrazole-3,4-diamine?
The IUPAC name of 1-(2,2-difluoroethyl)pyrazole-3,4-diamine (CID 66509523) is 1-(2,2-difluoroethyl)pyrazole-3,4-diamine.
What is the SMILES notation for 1-(2,2-difluoroethyl)pyrazole-3,4-diamine?
The canonical SMILES for 1-(2,2-difluoroethyl)pyrazole-3,4-diamine is Nc1cn(CC(F)F)nc1N.
What is the InChIKey of 1-(2,2-difluoroethyl)pyrazole-3,4-diamine?
The InChIKey is LAANYDXEGIGUEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2N4/c6-4(7)2-11-1-3(8)5(9)10-11/h1,4H,2,8H2,(H2,9,10).
What are the key properties of 1-(2,2-difluoroethyl)pyrazole-3,4-diamine?
1-(2,2-difluoroethyl)pyrazole-3,4-diamine has a molecular weight of 162.14 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)pyrazole-3,4-diamine is sourced from PubChem (CID 66509523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).