About 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine
5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine (PubChem CID 66509613) has the molecular formula C13H21IN4
and a molecular weight of 360.24 g/mol. Its IUPAC name is 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine |
| PubChem CID | 66509613 |
| Molecular Formula | C13H21IN4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine |
| SMILES | CC(C)N1CCCC1c1nc(N(C)C)ncc1I |
| InChI | InChI=1S/C13H21IN4/c1-9(2)18-7-5-6-11(18)12-10(14)8-15-13(16-12)17(3)4/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | VCMKUWFHLXJWAG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine?
The IUPAC name of 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine (CID 66509613) is 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine.
What is the SMILES notation for 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine?
The canonical SMILES for 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine is CC(C)N1CCCC1c1nc(N(C)C)ncc1I.
What is the InChIKey of 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine?
The InChIKey is VCMKUWFHLXJWAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21IN4/c1-9(2)18-7-5-6-11(18)12-10(14)8-15-13(16-12)17(3)4/h8-9,11H,5-7H2,1-4H3.
What are the key properties of 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine?
5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine has a molecular weight of 360.24 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N,N-dimethyl-4-(1-propan-2-ylpyrrolidin-2-yl)pyrimidin-2-amine is sourced from PubChem (CID 66509613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).