About 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine
5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine (PubChem CID 66509697) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine |
| PubChem CID | 66509697 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine |
| SMILES | COc1ccc(-c2cnc(N(C)C)nc2C2CNCCO2)cc1 |
| InChI | InChI=1S/C17H22N4O2/c1-21(2)17-19-10-14(12-4-6-13(22-3)7-5-12)16(20-17)15-11-18-8-9-23-15/h4-7,10,15,18H,8-9,11H2,1-3H3 |
| InChIKey | UMIBHYIMOQRABR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine?
The IUPAC name of 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine (CID 66509697) is 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine.
What is the SMILES notation for 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine?
The canonical SMILES for 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine is COc1ccc(-c2cnc(N(C)C)nc2C2CNCCO2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine?
The InChIKey is UMIBHYIMOQRABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-21(2)17-19-10-14(12-4-6-13(22-3)7-5-12)16(20-17)15-11-18-8-9-23-15/h4-7,10,15,18H,8-9,11H2,1-3H3.
What are the key properties of 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine?
5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine has a molecular weight of 314.39 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-N,N-dimethyl-4-morpholin-2-ylpyrimidin-2-amine is sourced from PubChem (CID 66509697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).