C11H15N5 — CID 66509746
1-methyl-3-piperidin-4-ylpyrazolo[3,4-b]pyrazine (PubChem CID 66509746) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 1-methyl-3-piperidin-4-ylpyrazolo[3,4-b]pyrazine.
| Compound Name | 1-methyl-3-piperidin-4-ylpyrazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 66509746 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-methyl-3-piperidin-4-ylpyrazolo[3,4-b]pyrazine |
| SMILES | Cn1nc(C2CCNCC2)c2nccnc21 |
| InChI | InChI=1S/C11H15N5/c1-16-11-10(13-6-7-14-11)9(15-16)8-2-4-12-5-3-8/h6-8,12H,2-5H2,1H3 |
| InChIKey | PKZPIVPGXFVPGN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |