About 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol
3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol (PubChem CID 66509758) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol |
| PubChem CID | 66509758 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol |
| SMILES | CN1CCCN(CC2(O)CCNC2)CC1 |
| InChI | InChI=1S/C11H23N3O/c1-13-5-2-6-14(8-7-13)10-11(15)3-4-12-9-11/h12,15H,2-10H2,1H3 |
| InChIKey | NRSSNRKWWDIQDY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol?
The IUPAC name of 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol (CID 66509758) is 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol.
What is the SMILES notation for 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol?
The canonical SMILES for 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol is CN1CCCN(CC2(O)CCNC2)CC1.
What is the InChIKey of 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol?
The InChIKey is NRSSNRKWWDIQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-13-5-2-6-14(8-7-13)10-11(15)3-4-12-9-11/h12,15H,2-10H2,1H3.
What are the key properties of 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol?
3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol has a molecular weight of 213.32 g/mol, XLogP of -0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,4-diazepan-1-yl)methyl]pyrrolidin-3-ol is sourced from PubChem (CID 66509758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).