C8H6Br2F3NO — CID 66510459
4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2,6-dibromophenol (PubChem CID 66510459) has the molecular formula C8H6Br2F3NO and a molecular weight of 348.94 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2,6-dibromophenol.
| Compound Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2,6-dibromophenol |
|---|---|
| PubChem CID | 66510459 |
| Molecular Formula | C8H6Br2F3NO |
| Molecular Weight | 348.94 g/mol |
| Exact Mass | 346.88 |
| IUPAC Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2,6-dibromophenol |
| SMILES | N[C@@H](c1cc(Br)c(O)c(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C8H6Br2F3NO/c9-4-1-3(2-5(10)6(4)15)7(14)8(11,12)13/h1-2,7,15H,14H2/t7-/m0/s1 |
| InChIKey | QTDPHZDRCYGBRH-ZETCQYMHSA-N |
| XLogP | 3.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |