C12H8Br2F3NO — CID 66510481
3-[(1R)-1-amino-2,2,2-trifluoroethyl]-1,6-dibromonaphthalen-2-ol (PubChem CID 66510481) has the molecular formula C12H8Br2F3NO and a molecular weight of 399.00 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-1,6-dibromonaphthalen-2-ol.
| Compound Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-1,6-dibromonaphthalen-2-ol |
|---|---|
| PubChem CID | 66510481 |
| Molecular Formula | C12H8Br2F3NO |
| Molecular Weight | 399.00 g/mol |
| Exact Mass | 396.89 |
| IUPAC Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]-1,6-dibromonaphthalen-2-ol |
| SMILES | N[C@H](c1cc2cc(Br)ccc2c(Br)c1O)C(F)(F)F |
| InChI | InChI=1S/C12H8Br2F3NO/c13-6-1-2-7-5(3-6)4-8(10(19)9(7)14)11(18)12(15,16)17/h1-4,11,19H,18H2/t11-/m1/s1 |
| InChIKey | HXSCJAMECHAUGO-LLVKDONJSA-N |
| XLogP | 4.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|