C16H12F3N — CID 66512030
(1S)-1-anthracen-9-yl-2,2,2-trifluoroethanamine (PubChem CID 66512030) has the molecular formula C16H12F3N and a molecular weight of 275.27 g/mol. Its IUPAC name is (1S)-1-anthracen-9-yl-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-anthracen-9-yl-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66512030 |
| Molecular Formula | C16H12F3N |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (1S)-1-anthracen-9-yl-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1c2ccccc2cc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C16H12F3N/c17-16(18,19)15(20)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15H,20H2/t15-/m0/s1 |
| InChIKey | KKAPHUQWVJTVRZ-HNNXBMFYSA-N |
| XLogP | 4.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|